About carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole
carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole (PubChem CID 176534536) has the molecular formula C18H12F3N3O2S
and a molecular weight of 391.37 g/mol. Its IUPAC name is carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole.
Molecular Properties
| Compound Name | carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole |
| PubChem CID | 176534536 |
| Molecular Formula | C18H12F3N3O2S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole |
| SMILES | FC(F)(F)Sc1ccc(-c2ccc(C=Cc3cn[nH]n3)cc2)cc1.O=C=O |
| InChI | InChI=1S/C17H12F3N3S.CO2/c18-17(19,20)24-16-9-6-14(7-10-16)13-4-1-12(2-5-13)3-8-15-11-21-23-22-15;2-1-3/h1-11H,(H,21,22,23); |
| InChIKey | CVBOENYMGIGWMK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole?
The IUPAC name of carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole (CID 176534536) is carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole.
What is the SMILES notation for carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole?
The canonical SMILES for carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole is FC(F)(F)Sc1ccc(-c2ccc(C=Cc3cn[nH]n3)cc2)cc1.O=C=O.
What is the InChIKey of carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole?
The InChIKey is CVBOENYMGIGWMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N3S.CO2/c18-17(19,20)24-16-9-6-14(7-10-16)13-4-1-12(2-5-13)3-8-15-11-21-23-22-15;2-1-3/h1-11H,(H,21,22,23);.
What are the key properties of carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole?
carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole has a molecular weight of 391.37 g/mol, XLogP of 4.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-[2-[4-[4-(trifluoromethylsulfanyl)phenyl]phenyl]ethenyl]-2H-triazole is sourced from PubChem (CID 176534536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).