About 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine
2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine (PubChem CID 176534539) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine.
Molecular Properties
| Compound Name | 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine |
| PubChem CID | 176534539 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine |
| SMILES | [H]/N=C1\CC(N(C)C)=NC2(CCCCC2)N1 |
| InChI | InChI=1S/C11H20N4/c1-15(2)10-8-9(12)13-11(14-10)6-4-3-5-7-11/h3-8H2,1-2H3,(H2,12,13) |
| InChIKey | CVLVPLRGSBKYJJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine?
The IUPAC name of 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine (CID 176534539) is 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine.
What is the SMILES notation for 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine?
The canonical SMILES for 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine is [H]/N=C1\CC(N(C)C)=NC2(CCCCC2)N1.
What is the InChIKey of 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine?
The InChIKey is CVLVPLRGSBKYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-15(2)10-8-9(12)13-11(14-10)6-4-3-5-7-11/h3-8H2,1-2H3,(H2,12,13).
What are the key properties of 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine?
2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine has a molecular weight of 208.31 g/mol, XLogP of 1.58, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-N,N-dimethyl-1,5-diazaspiro[5.5]undec-4-en-4-amine is sourced from PubChem (CID 176534539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).