C28H33NO2 — CID 176534657
1-[[(13Z)-2,12-dimethyl-4-tricyclo[13.5.0.05,10]icosa-1(15),2,4,6,8,10,11,13,16,18-decaenyl]amino]-3-propoxypropan-2-ol (PubChem CID 176534657) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-[[(13Z)-2,12-dimethyl-4-tricyclo[13.5.0.05,10]icosa-1(15),2,4,6,8,10,11,13,16,18-decaenyl]amino]-3-propoxypropan-2-ol.
| Compound Name | 1-[[(13Z)-2,12-dimethyl-4-tricyclo[13.5.0.05,10]icosa-1(15),2,4,6,8,10,11,13,16,18-decaenyl]amino]-3-propoxypropan-2-ol |
|---|---|
| PubChem CID | 176534657 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-[[(13Z)-2,12-dimethyl-4-tricyclo[13.5.0.05,10]icosa-1(15),2,4,6,8,10,11,13,16,18-decaenyl]amino]-3-propoxypropan-2-ol |
| SMILES | CCCOCC(O)CNC1=c2ccccc2=C=C(C)/C=C/C2=C(CC=CC=C2)C(C)=C1 |
| InChI | InChI=1S/C28H33NO2/c1-4-16-31-20-25(30)19-29-28-18-22(3)26-12-7-5-6-10-23(26)15-14-21(2)17-24-11-8-9-13-27(24)28/h5-11,13-15,18,25,29-30H,4,12,16,19-20H2,1-3H3/b15-14+,22-18?,28-27? |
| InChIKey | YTLNXXJERXRKOB-HWPUEWBGSA-N |
| XLogP | 3.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|