C8H8N4S — CID 176534912
4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),2,5,9-tetraene (PubChem CID 176534912) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),2,5,9-tetraene.
| Compound Name | 4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),2,5,9-tetraene |
|---|---|
| PubChem CID | 176534912 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),2,5,9-tetraene |
| SMILES | C1=CN2CC3=CNCN=C3N=C2S1 |
| InChI | InChI=1S/C8H8N4S/c1-2-13-8-11-7-6(4-12(1)8)3-9-5-10-7/h1-3,9H,4-5H2 |
| InChIKey | SLAUICLQNKRUAE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |