C26H32F3N3O3 — CID 176535238
N-[2-(cyclopropylmethoxy)ethyl]-2-[(4-iminocycloheptyl)methyl]-8-(2,2,2-trifluoroethoxy)isoquinoline-7-carboxamide (PubChem CID 176535238) has the molecular formula C26H32F3N3O3 and a molecular weight of 491.55 g/mol. Its IUPAC name is N-[2-(cyclopropylmethoxy)ethyl]-2-[(4-iminocycloheptyl)methyl]-8-(2,2,2-trifluoroethoxy)isoquinoline-7-carboxamide.
| Compound Name | N-[2-(cyclopropylmethoxy)ethyl]-2-[(4-iminocycloheptyl)methyl]-8-(2,2,2-trifluoroethoxy)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 176535238 |
| Molecular Formula | C26H32F3N3O3 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-[2-(cyclopropylmethoxy)ethyl]-2-[(4-iminocycloheptyl)methyl]-8-(2,2,2-trifluoroethoxy)isoquinoline-7-carboxamide |
| SMILES | [H]/N=C1\CCCC(CN2C=C=c3ccc(C(=O)NCCOCC4CC4)c(OCC(F)(F)F)c3=C2)CC1 |
| InChI | InChI=1S/C26H32F3N3O3/c27-26(28,29)17-35-24-22(25(33)31-11-13-34-16-19-4-5-19)9-7-20-10-12-32(15-23(20)24)14-18-2-1-3-21(30)8-6-18/h7,9,12,15,18-19,30H,1-6,8,11,13-14,16-17H2,(H,31,33)/b30-21+ |
| InChIKey | QNUMOXPITYQCRP-MWAVMZGNSA-N |
| XLogP | 3.33 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|