C11H17N5 — CID 176535388
6-[(2Z,4Z)-hepta-2,4,6-trienyl]imino-2-methyl-2,3-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 176535388) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 6-[(2Z,4Z)-hepta-2,4,6-trienyl]imino-2-methyl-2,3-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-[(2Z,4Z)-hepta-2,4,6-trienyl]imino-2-methyl-2,3-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 176535388 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 6-[(2Z,4Z)-hepta-2,4,6-trienyl]imino-2-methyl-2,3-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | C=C/C=C\C=C/C/N=C1\N=C(N)NC(C)N1 |
| InChI | InChI=1S/C11H17N5/c1-3-4-5-6-7-8-13-11-15-9(2)14-10(12)16-11/h3-7,9H,1,8H2,2H3,(H4,12,13,14,15,16)/b5-4-,7-6- |
| InChIKey | VOBVWDZPJNHKFA-RZSVFLSASA-N |
| XLogP | 0.49 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|