C10H20N5O9P — CID 176535404
2-carbamimidoyl-1,1-dimethylguanidine;[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate (PubChem CID 176535404) has the molecular formula C10H20N5O9P and a molecular weight of 385.27 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 176535404 |
| Molecular Formula | C10H20N5O9P |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] dihydrogen phosphate |
| SMILES | O=C1OC(C(O)CO)C(O)=C1OP(=O)(O)O.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C6H9O9P.C4H11N5/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;1-9(2)4(7)8-3(5)6/h2,4,7-9H,1H2,(H2,11,12,13);1-2H3,(H5,5,6,7,8) |
| InChIKey | WCFSGQPOMGRUGN-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 245.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|