C34H41F5N4O — CID 176535424
N-[2-cyclopropyl-2-[6-(3,4-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propa-1,2-dien-1-amine;2,4-dimethyl-6-(methyliminomethyl)aniline;ethane (PubChem CID 176535424) has the molecular formula C34H41F5N4O and a molecular weight of 616.72 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-[6-(3,4-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propa-1,2-dien-1-amine;2,4-dimethyl-6-(methyliminomethyl)aniline;ethane.
| Compound Name | N-[2-cyclopropyl-2-[6-(3,4-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propa-1,2-dien-1-amine;2,4-dimethyl-6-(methyliminomethyl)aniline;ethane |
|---|---|
| PubChem CID | 176535424 |
| Molecular Formula | C34H41F5N4O |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | N-[2-cyclopropyl-2-[6-(3,4-difluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propa-1,2-dien-1-amine;2,4-dimethyl-6-(methyliminomethyl)aniline;ethane |
| SMILES | C/N=C/c1cc(C)cc(C)c1N.C=C=CNCC(c1cc(C)c(OCC(F)(F)F)c(-c2ccc(F)c(F)c2)n1)C1CC1.CC |
| InChI | InChI=1S/C22H21F5N2O.C10H14N2.C2H6/c1-3-8-28-11-16(14-4-5-14)19-9-13(2)21(30-12-22(25,26)27)20(29-19)15-6-7-17(23)18(24)10-15;1-7-4-8(2)10(11)9(5-7)6-12-3;1-2/h6-10,14,16,28H,1,4-5,11-12H2,2H3;4-6H,11H2,1-3H3;1-2H3/b;12-6+; |
| InChIKey | REHOJQFJURYKQF-JFOHBEEMSA-N |
| XLogP | 8.62 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|