About 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine
6,7-dihydropyrrolo[2,3-c]pyridin-5-imine (PubChem CID 176535434) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine.
Molecular Properties
| Compound Name | 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine |
| PubChem CID | 176535434 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine |
| SMILES | [H]/N=C1\C=C2C=CN=C2CN1 |
| InChI | InChI=1S/C7H7N3/c8-7-3-5-1-2-9-6(5)4-10-7/h1-3H,4H2,(H2,8,10) |
| InChIKey | QVJXIVKDDHTZDD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine?
The IUPAC name of 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine (CID 176535434) is 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine.
What is the SMILES notation for 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine?
The canonical SMILES for 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine is [H]/N=C1\C=C2C=CN=C2CN1.
What is the InChIKey of 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine?
The InChIKey is QVJXIVKDDHTZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c8-7-3-5-1-2-9-6(5)4-10-7/h1-3H,4H2,(H2,8,10).
What are the key properties of 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine?
6,7-dihydropyrrolo[2,3-c]pyridin-5-imine has a molecular weight of 133.15 g/mol, XLogP of 0.46, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydropyrrolo[2,3-c]pyridin-5-imine is sourced from PubChem (CID 176535434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).