C18H33N5O4 — CID 176536214
tert-butyl N-[N'-[2-(tert-butyliminomethylideneamino)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 176536214) has the molecular formula C18H33N5O4 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl N-[N'-[2-(tert-butyliminomethylideneamino)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[2-(tert-butyliminomethylideneamino)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 176536214 |
| Molecular Formula | C18H33N5O4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | tert-butyl N-[N'-[2-(tert-butyliminomethylideneamino)ethyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)N=C=NCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33N5O4/c1-16(2,3)21-12-19-10-11-20-13(22-14(24)26-17(4,5)6)23-15(25)27-18(7,8)9/h10-11H2,1-9H3,(H2,20,22,23,24,25) |
| InChIKey | CUUBLXZYWPJMOU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|