C9H6N2OS — CID 176536436
2-(2-amino-1,3-benzothiazol-4-yl)ethenone (PubChem CID 176536436) has the molecular formula C9H6N2OS and a molecular weight of 190.23 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-4-yl)ethenone.
| Compound Name | 2-(2-amino-1,3-benzothiazol-4-yl)ethenone |
|---|---|
| PubChem CID | 176536436 |
| Molecular Formula | C9H6N2OS |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-4-yl)ethenone |
| SMILES | Nc1nc2c(C=C=O)cccc2s1 |
| InChI | InChI=1S/C9H6N2OS/c10-9-11-8-6(4-5-12)2-1-3-7(8)13-9/h1-4H,(H2,10,11) |
| InChIKey | VGCYMZSRHDOVMQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|