C4H8ClN5 — CID 176537002
6-methyl-2,4-dihydro-1,2,4,5-tetrazepin-3-imine;hydrochloride (PubChem CID 176537002) has the molecular formula C4H8ClN5 and a molecular weight of 161.60 g/mol. Its IUPAC name is 6-methyl-2,4-dihydro-1,2,4,5-tetrazepin-3-imine;hydrochloride.
| Compound Name | 6-methyl-2,4-dihydro-1,2,4,5-tetrazepin-3-imine;hydrochloride |
|---|---|
| PubChem CID | 176537002 |
| Molecular Formula | C4H8ClN5 |
| Molecular Weight | 161.60 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 6-methyl-2,4-dihydro-1,2,4,5-tetrazepin-3-imine;hydrochloride |
| SMILES | Cl.[H]/N=C1\NN=CC(C)=NN1 |
| InChI | InChI=1S/C4H7N5.ClH/c1-3-2-6-8-4(5)9-7-3;/h2H,1H3,(H3,5,8,9);1H |
| InChIKey | CVGDJVJXKAMFNM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.60 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|