C32H61N5O3S — CID 176537474
1-carbamimidoylguanidine;2,3,4-trioctylbenzenesulfonic acid (PubChem CID 176537474) has the molecular formula C32H61N5O3S and a molecular weight of 595.94 g/mol. Its IUPAC name is 1-carbamimidoylguanidine;2,3,4-trioctylbenzenesulfonic acid.
| Compound Name | 1-carbamimidoylguanidine;2,3,4-trioctylbenzenesulfonic acid |
|---|---|
| PubChem CID | 176537474 |
| Molecular Formula | C32H61N5O3S |
| Molecular Weight | 595.94 g/mol |
| Exact Mass | 595.45 |
| IUPAC Name | 1-carbamimidoylguanidine;2,3,4-trioctylbenzenesulfonic acid |
| SMILES | CCCCCCCCc1ccc(S(=O)(=O)O)c(CCCCCCCC)c1CCCCCCCC.[H]/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C30H54O3S.C2H7N5/c1-4-7-10-13-16-19-22-27-25-26-30(34(31,32)33)29(24-21-18-15-12-9-6-3)28(27)23-20-17-14-11-8-5-2;3-1(4)7-2(5)6/h25-26H,4-24H2,1-3H3,(H,31,32,33);(H7,3,4,5,6,7) |
| InChIKey | XSBVYQPHBBHTEZ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.94 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|