About N-(3-aminopropa-1,2-dienyl)acetamide
N-(3-aminopropa-1,2-dienyl)acetamide (PubChem CID 176537565) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is N-(3-aminopropa-1,2-dienyl)acetamide.
Molecular Properties
| Compound Name | N-(3-aminopropa-1,2-dienyl)acetamide |
| PubChem CID | 176537565 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | N-(3-aminopropa-1,2-dienyl)acetamide |
| SMILES | CC(=O)NC=C=CN |
| InChI | InChI=1S/C5H8N2O/c1-5(8)7-4-2-3-6/h3-4H,6H2,1H3,(H,7,8) |
| InChIKey | YLAVZRLICUYHJR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-aminopropa-1,2-dienyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropa-1,2-dienyl)acetamide?
The IUPAC name of N-(3-aminopropa-1,2-dienyl)acetamide (CID 176537565) is N-(3-aminopropa-1,2-dienyl)acetamide.
What is the SMILES notation for N-(3-aminopropa-1,2-dienyl)acetamide?
The canonical SMILES for N-(3-aminopropa-1,2-dienyl)acetamide is CC(=O)NC=C=CN.
What is the InChIKey of N-(3-aminopropa-1,2-dienyl)acetamide?
The InChIKey is YLAVZRLICUYHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-5(8)7-4-2-3-6/h3-4H,6H2,1H3,(H,7,8).
What are the key properties of N-(3-aminopropa-1,2-dienyl)acetamide?
N-(3-aminopropa-1,2-dienyl)acetamide has a molecular weight of 112.13 g/mol, XLogP of -0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropa-1,2-dienyl)acetamide is sourced from PubChem (CID 176537565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).