C19H31N5O3S — CID 176537575
[[(3S,4S)-8-[4-amino-1-methyl-6-(oxomethylidene)pyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 176537575) has the molecular formula C19H31N5O3S and a molecular weight of 409.56 g/mol. Its IUPAC name is [[(3S,4S)-8-[4-amino-1-methyl-6-(oxomethylidene)pyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(3S,4S)-8-[4-amino-1-methyl-6-(oxomethylidene)pyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 176537575 |
| Molecular Formula | C19H31N5O3S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [[(3S,4S)-8-[4-amino-1-methyl-6-(oxomethylidene)pyrimidin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | C[C@@H]1OCC2(CCN(C3=NC(N)=CC(=C=O)N3C)CC2)[C@@H]1N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C19H31N5O3S/c1-13-16(22-28(26)18(2,3)4)19(12-27-13)6-8-24(9-7-19)17-21-15(20)10-14(11-25)23(17)5/h10,13,16,22H,6-9,12,20H2,1-5H3/t13-,16+,28?/m0/s1 |
| InChIKey | JFMVDWMCXWIAGJ-YCPIQFNJSA-N |
| XLogP | 0.72 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|