About carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate
carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate (PubChem CID 176538040) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate.
Molecular Properties
| Compound Name | carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate |
| PubChem CID | 176538040 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate |
| SMILES | CCOC(=O)C(C)(CC)c1ccc(=O)[nH]c1.O=C=O |
| InChI | InChI=1S/C12H17NO3.CO2/c1-4-12(3,11(15)16-5-2)9-6-7-10(14)13-8-9;2-1-3/h6-8H,4-5H2,1-3H3,(H,13,14); |
| InChIKey | UMJINDYAOSCRCG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate?
The IUPAC name of carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate (CID 176538040) is carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate.
What is the SMILES notation for carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate?
The canonical SMILES for carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate is CCOC(=O)C(C)(CC)c1ccc(=O)[nH]c1.O=C=O.
What is the InChIKey of carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate?
The InChIKey is UMJINDYAOSCRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3.CO2/c1-4-12(3,11(15)16-5-2)9-6-7-10(14)13-8-9;2-1-3/h6-8H,4-5H2,1-3H3,(H,13,14);.
What are the key properties of carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate?
carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate has a molecular weight of 267.28 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;ethyl 2-methyl-2-(6-oxo-1H-pyridin-3-yl)butanoate is sourced from PubChem (CID 176538040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).