About 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid
2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 176538839) has the molecular formula C10H10N2O5
and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 176538839 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CN(C)C1=C(C(=O)O)C=CC(=C=O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O5/c1-11(2)9-7(10(14)15)4-3-6(5-13)8(9)12(16)17/h3-4,8H,1-2H3,(H,14,15) |
| InChIKey | BGLUSGBUCNVAKQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid (CID 176538839) is 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid is CN(C)C1=C(C(=O)O)C=CC(=C=O)C1[N+](=O)[O-].
What is the InChIKey of 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is BGLUSGBUCNVAKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O5/c1-11(2)9-7(10(14)15)4-3-6(5-13)8(9)12(16)17/h3-4,8H,1-2H3,(H,14,15).
What are the key properties of 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid?
2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 238.20 g/mol, XLogP of -0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-3-nitro-4-(oxomethylidene)cyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 176538839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).