C16H24FN5 — CID 176539404
(3E)-2-ethyl-3-[[[(2Z)-2-[(fluoroamino)methyliminomethyl]-4-methylpenta-2,4-dienyl]amino]methylidene]-4H-pyridin-4-amine (PubChem CID 176539404) has the molecular formula C16H24FN5 and a molecular weight of 305.40 g/mol. Its IUPAC name is (3E)-2-ethyl-3-[[[(2Z)-2-[(fluoroamino)methyliminomethyl]-4-methylpenta-2,4-dienyl]amino]methylidene]-4H-pyridin-4-amine.
| Compound Name | (3E)-2-ethyl-3-[[[(2Z)-2-[(fluoroamino)methyliminomethyl]-4-methylpenta-2,4-dienyl]amino]methylidene]-4H-pyridin-4-amine |
|---|---|
| PubChem CID | 176539404 |
| Molecular Formula | C16H24FN5 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (3E)-2-ethyl-3-[[[(2Z)-2-[(fluoroamino)methyliminomethyl]-4-methylpenta-2,4-dienyl]amino]methylidene]-4H-pyridin-4-amine |
| SMILES | C=C(C)/C=C(\C=NCNF)CN/C=C1/C(CC)=NC=CC1N |
| InChI | InChI=1S/C16H24FN5/c1-4-16-14(15(18)5-6-21-16)10-19-8-13(7-12(2)3)9-20-11-22-17/h5-7,9-10,15,19,22H,2,4,8,11,18H2,1,3H3/b13-7-,14-10+,20-9? |
| InChIKey | INPXHLGGDSNVBY-XQWRPTBISA-N |
| XLogP | 2.17 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|