C26H31N3O — CID 176539643
[4-[(1E,3Z)-1-(2-methylimino-4-propa-1,2-dienyl-1,3-dihydroazepin-7-yl)penta-1,3-dien-2-yl]cyclohexa-1,5-dien-1-yl]-pyrrolidin-1-ylmethanone (PubChem CID 176539643) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is [4-[(1E,3Z)-1-(2-methylimino-4-propa-1,2-dienyl-1,3-dihydroazepin-7-yl)penta-1,3-dien-2-yl]cyclohexa-1,5-dien-1-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[(1E,3Z)-1-(2-methylimino-4-propa-1,2-dienyl-1,3-dihydroazepin-7-yl)penta-1,3-dien-2-yl]cyclohexa-1,5-dien-1-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 176539643 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | [4-[(1E,3Z)-1-(2-methylimino-4-propa-1,2-dienyl-1,3-dihydroazepin-7-yl)penta-1,3-dien-2-yl]cyclohexa-1,5-dien-1-yl]-pyrrolidin-1-ylmethanone |
| SMILES | C=C=CC1=CC=C(/C=C(\C=C/C)C2C=CC(C(=O)N3CCCC3)=CC2)N/C(=N/C)C1 |
| InChI | InChI=1S/C26H31N3O/c1-4-8-20-10-15-24(28-25(18-20)27-3)19-23(9-5-2)21-11-13-22(14-12-21)26(30)29-16-6-7-17-29/h5,8-11,13-15,19,21H,1,6-7,12,16-18H2,2-3H3,(H,27,28)/b9-5-,23-19+ |
| InChIKey | GZFHPLAOOPAIAP-NIEVRLAOSA-N |
| XLogP | 4.79 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|