C20H20FN5O3 — CID 176540248
(4R,6S)-9-fluoro-4-hydroxy-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19,20,23-heptaen-18-one (PubChem CID 176540248) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is (4R,6S)-9-fluoro-4-hydroxy-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19,20,23-heptaen-18-one.
| Compound Name | (4R,6S)-9-fluoro-4-hydroxy-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19,20,23-heptaen-18-one |
|---|---|
| PubChem CID | 176540248 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (4R,6S)-9-fluoro-4-hydroxy-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19,20,23-heptaen-18-one |
| SMILES | O=C1NCCCOc2ccc(F)cc2[C@@H]2C[C@@H](O)CN2C2=NC3C1=C=NN3C=C2 |
| InChI | InChI=1S/C20H20FN5O3/c21-12-2-3-17-14(8-12)16-9-13(27)11-25(16)18-4-6-26-19(24-18)15(10-23-26)20(28)22-5-1-7-29-17/h2-4,6,8,13,16,19,27H,1,5,7,9,11H2,(H,22,28)/t13-,16+,19?/m1/s1 |
| InChIKey | PMUPNSCJTZBOLR-MSJIKYQXSA-N |
| XLogP | 0.91 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |