About 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine
2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine (PubChem CID 176540586) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine |
| PubChem CID | 176540586 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cccc1N.Nc1ccccc1C=C=O |
| InChI | InChI=1S/C8H7NO.C7H10N2/c9-8-4-2-1-3-7(8)5-6-10;1-5-6(8)3-2-4-7(5)9/h1-5H,9H2;2-4H,8-9H2,1H3 |
| InChIKey | KTHIKDQSRMMBNX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine?
The IUPAC name of 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine (CID 176540586) is 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine.
What is the SMILES notation for 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine?
The canonical SMILES for 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine is Cc1c(N)cccc1N.Nc1ccccc1C=C=O.
What is the InChIKey of 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine?
The InChIKey is KTHIKDQSRMMBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.C7H10N2/c9-8-4-2-1-3-7(8)5-6-10;1-5-6(8)3-2-4-7(5)9/h1-5H,9H2;2-4H,8-9H2,1H3.
What are the key properties of 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine?
2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine has a molecular weight of 255.32 g/mol, XLogP of 2.27, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)ethenone;2-methylbenzene-1,3-diamine is sourced from PubChem (CID 176540586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).