About 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine
1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine (PubChem CID 176540726) has the molecular formula C12H27N5
and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine.
Molecular Properties
| Compound Name | 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine |
| PubChem CID | 176540726 |
| Molecular Formula | C12H27N5 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.23 |
| IUPAC Name | 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/CCCCCCC(C)(C)C |
| InChI | InChI=1S/C12H27N5/c1-12(2,3)8-6-4-5-7-9-16-11(15)17-10(13)14/h4-9H2,1-3H3,(H6,13,14,15,16,17) |
| InChIKey | HHVHNPUPHROGGK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine?
The IUPAC name of 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine (CID 176540726) is 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine.
What is the SMILES notation for 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine?
The canonical SMILES for 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine is [H]/N=C(\N)N/C(N)=N/CCCCCCC(C)(C)C.
What is the InChIKey of 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine?
The InChIKey is HHVHNPUPHROGGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N5/c1-12(2,3)8-6-4-5-7-9-16-11(15)17-10(13)14/h4-9H2,1-3H3,(H6,13,14,15,16,17).
What are the key properties of 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine?
1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine has a molecular weight of 241.38 g/mol, XLogP of 1.78, 6 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-2-(7,7-dimethyloctyl)guanidine is sourced from PubChem (CID 176540726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).