C16H23FN2 — CID 176540738
(2Z)-3-ethyl-6-[(2Z)-1-fluorohepta-2,4-dien-2-yl]-1-azacycloocta-2,4,5-trien-2-amine (PubChem CID 176540738) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is (2Z)-3-ethyl-6-[(2Z)-1-fluorohepta-2,4-dien-2-yl]-1-azacycloocta-2,4,5-trien-2-amine.
| Compound Name | (2Z)-3-ethyl-6-[(2Z)-1-fluorohepta-2,4-dien-2-yl]-1-azacycloocta-2,4,5-trien-2-amine |
|---|---|
| PubChem CID | 176540738 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2Z)-3-ethyl-6-[(2Z)-1-fluorohepta-2,4-dien-2-yl]-1-azacycloocta-2,4,5-trien-2-amine |
| SMILES | CCC=C/C=C(\CF)C1=C=C/C(CC)=C(/N)NCC1 |
| InChI | InChI=1S/C16H23FN2/c1-3-5-6-7-15(12-17)14-9-8-13(4-2)16(18)19-11-10-14/h5-8,19H,3-4,10-12,18H2,1-2H3/b6-5?,15-7+,16-13- |
| InChIKey | QUVYBQFMYBKXLZ-BWCSGMLMSA-N |
| XLogP | 3.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|