About 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one
2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one (PubChem CID 176540906) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one.
Molecular Properties
| Compound Name | 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one |
| PubChem CID | 176540906 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one |
| SMILES | [H]/N=C1\NC(=O)C2N=C(C)C(C)=NC2N1 |
| InChI | InChI=1S/C8H11N5O/c1-3-4(2)11-6-5(10-3)7(14)13-8(9)12-6/h5-6H,1-2H3,(H3,9,12,13,14) |
| InChIKey | WHAOXCZMLWRPRN-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one?
The IUPAC name of 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one (CID 176540906) is 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one.
What is the SMILES notation for 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one?
The canonical SMILES for 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one is [H]/N=C1\NC(=O)C2N=C(C)C(C)=NC2N1.
What is the InChIKey of 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one?
The InChIKey is WHAOXCZMLWRPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c1-3-4(2)11-6-5(10-3)7(14)13-8(9)12-6/h5-6H,1-2H3,(H3,9,12,13,14).
What are the key properties of 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one?
2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one has a molecular weight of 193.21 g/mol, XLogP of -0.73, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-6,7-dimethyl-4a,8a-dihydro-1H-pteridin-4-one is sourced from PubChem (CID 176540906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).