About hexa-4,5-diene-1,4-diol
hexa-4,5-diene-1,4-diol (PubChem CID 176541004) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is hexa-4,5-diene-1,4-diol.
Molecular Properties
| Compound Name | hexa-4,5-diene-1,4-diol |
| PubChem CID | 176541004 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | hexa-4,5-diene-1,4-diol |
| SMILES | C=C=C(O)CCCO |
| InChI | InChI=1S/C6H10O2/c1-2-6(8)4-3-5-7/h7-8H,1,3-5H2 |
| InChIKey | JHLBGISPPOSZQO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze hexa-4,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-4,5-diene-1,4-diol?
The IUPAC name of hexa-4,5-diene-1,4-diol (CID 176541004) is hexa-4,5-diene-1,4-diol.
What is the SMILES notation for hexa-4,5-diene-1,4-diol?
The canonical SMILES for hexa-4,5-diene-1,4-diol is C=C=C(O)CCCO.
What is the InChIKey of hexa-4,5-diene-1,4-diol?
The InChIKey is JHLBGISPPOSZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-2-6(8)4-3-5-7/h7-8H,1,3-5H2.
What are the key properties of hexa-4,5-diene-1,4-diol?
hexa-4,5-diene-1,4-diol has a molecular weight of 114.14 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-4,5-diene-1,4-diol is sourced from PubChem (CID 176541004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).