C10H10N4 — CID 176541059
1,3,5,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2,6,8,10,13-pentaene (PubChem CID 176541059) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 1,3,5,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2,6,8,10,13-pentaene.
| Compound Name | 1,3,5,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2,6,8,10,13-pentaene |
|---|---|
| PubChem CID | 176541059 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,3,5,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2,6,8,10,13-pentaene |
| SMILES | C1=CN2C(=NC1)C=CC1=CNCN=C12 |
| InChI | InChI=1S/C10H10N4/c1-4-12-9-3-2-8-6-11-7-13-10(8)14(9)5-1/h1-3,5-6,11H,4,7H2 |
| InChIKey | VXHNUAKCONBJMS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |