C29H43NO6 — CID 176541129
(4R,5S)-3-[(2R,3S,4S)-2-ethyl-5-[(2R,3R)-2-ethyl-3-[2-[(2R,3R)-2-ethyl-3-methyloxiran-2-yl]ethyl]oxiran-2-yl]-3-hydroxy-4-methylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 176541129) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is (4R,5S)-3-[(2R,3S,4S)-2-ethyl-5-[(2R,3R)-2-ethyl-3-[2-[(2R,3R)-2-ethyl-3-methyloxiran-2-yl]ethyl]oxiran-2-yl]-3-hydroxy-4-methylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R,3S,4S)-2-ethyl-5-[(2R,3R)-2-ethyl-3-[2-[(2R,3R)-2-ethyl-3-methyloxiran-2-yl]ethyl]oxiran-2-yl]-3-hydroxy-4-methylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 176541129 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | (4R,5S)-3-[(2R,3S,4S)-2-ethyl-5-[(2R,3R)-2-ethyl-3-[2-[(2R,3R)-2-ethyl-3-methyloxiran-2-yl]ethyl]oxiran-2-yl]-3-hydroxy-4-methylpentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C)[C@@H](O)[C@@H](C)C[C@@]1(CC)O[C@@H]1CC[C@@]1(CC)O[C@@H]1C |
| InChI | InChI=1S/C29H43NO6/c1-7-22(26(32)30-19(5)25(34-27(30)33)21-13-11-10-12-14-21)24(31)18(4)17-29(9-3)23(36-29)15-16-28(8-2)20(6)35-28/h10-14,18-20,22-25,31H,7-9,15-17H2,1-6H3/t18-,19+,20+,22+,23+,24-,25+,28+,29+/m0/s1 |
| InChIKey | PLMSSXURLNIBST-CWZDORBJSA-N |
| XLogP | 5.40 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|