C19H28N6 — CID 176541292
1-[(1E,3Z)-1-[(3E,4Z)-3-[(E)-3-(diaminomethylideneamino)but-2-enylidene]-4-ethylidene-2-methylcyclopenten-1-yl]penta-1,3-dien-2-yl]guanidine (PubChem CID 176541292) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is 1-[(1E,3Z)-1-[(3E,4Z)-3-[(E)-3-(diaminomethylideneamino)but-2-enylidene]-4-ethylidene-2-methylcyclopenten-1-yl]penta-1,3-dien-2-yl]guanidine.
| Compound Name | 1-[(1E,3Z)-1-[(3E,4Z)-3-[(E)-3-(diaminomethylideneamino)but-2-enylidene]-4-ethylidene-2-methylcyclopenten-1-yl]penta-1,3-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 176541292 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-[(1E,3Z)-1-[(3E,4Z)-3-[(E)-3-(diaminomethylideneamino)but-2-enylidene]-4-ethylidene-2-methylcyclopenten-1-yl]penta-1,3-dien-2-yl]guanidine |
| SMILES | [H]/N=C(\N)NC(/C=C\C)=C/C1=C(C)C(=C/C=C(\C)N=C(N)N)/C(=C\C)C1 |
| InChI | InChI=1S/C19H28N6/c1-5-7-16(25-19(22)23)11-15-10-14(6-2)17(13(15)4)9-8-12(3)24-18(20)21/h5-9,11H,10H2,1-4H3,(H4,20,21,24)(H4,22,23,25)/b7-5-,12-8+,14-6-,16-11+,17-9- |
| InChIKey | CHYYNPKXGCOPSO-HXOWCTGESA-N |
| XLogP | 2.70 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|