C37H44FN5O8S2-2 — CID 176541360
2-[4-(2,7-diazaspiro[3.5]nonan-2-yl)pyrimidin-5-yl]oxy-N-ethyl-5-fluoro-N-propan-2-ylbenzamide;bis(4-methylbenzenesulfonate) (PubChem CID 176541360) has the molecular formula C37H44FN5O8S2-2 and a molecular weight of 769.92 g/mol. Its IUPAC name is 2-[4-(2,7-diazaspiro[3.5]nonan-2-yl)pyrimidin-5-yl]oxy-N-ethyl-5-fluoro-N-propan-2-ylbenzamide;bis(4-methylbenzenesulfonate).
| Compound Name | 2-[4-(2,7-diazaspiro[3.5]nonan-2-yl)pyrimidin-5-yl]oxy-N-ethyl-5-fluoro-N-propan-2-ylbenzamide;bis(4-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 176541360 |
| Molecular Formula | C37H44FN5O8S2-2 |
| Molecular Weight | 769.92 g/mol |
| Exact Mass | 769.26 |
| IUPAC Name | 2-[4-(2,7-diazaspiro[3.5]nonan-2-yl)pyrimidin-5-yl]oxy-N-ethyl-5-fluoro-N-propan-2-ylbenzamide;bis(4-methylbenzenesulfonate) |
| SMILES | CCN(C(=O)c1cc(F)ccc1Oc1cncnc1N1CC2(CCNCC2)C1)C(C)C.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C23H30FN5O2.2C7H8O3S/c1-4-29(16(2)3)22(30)18-11-17(24)5-6-19(18)31-20-12-26-15-27-21(20)28-13-23(14-28)7-9-25-10-8-23;2*1-6-2-4-7(5-3-6)11(8,9)10/h5-6,11-12,15-16,25H,4,7-10,13-14H2,1-3H3;2*2-5H,1H3,(H,8,9,10)/p-2 |
| InChIKey | VXRJUGCDVVWUNL-UHFFFAOYSA-L |
| XLogP | 5.27 |
| TPSA | 184.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|