C21H18Cl2N6OS — CID 176541622
N'-[(2-chlorocyclohepta-1,3,5,6-tetraen-1-yl)methyl]-5-(5-chlorothiophen-2-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 176541622) has the molecular formula C21H18Cl2N6OS and a molecular weight of 473.39 g/mol. Its IUPAC name is N'-[(2-chlorocyclohepta-1,3,5,6-tetraen-1-yl)methyl]-5-(5-chlorothiophen-2-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N'-[(2-chlorocyclohepta-1,3,5,6-tetraen-1-yl)methyl]-5-(5-chlorothiophen-2-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 176541622 |
| Molecular Formula | C21H18Cl2N6OS |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N'-[(2-chlorocyclohepta-1,3,5,6-tetraen-1-yl)methyl]-5-(5-chlorothiophen-2-yl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CC1=C(Cl)C=CC=C=C1)N1CC(N2CCCC2=O)C(c2ccc(Cl)s2)=N1 |
| InChI | InChI=1S/C21H18Cl2N6OS/c22-15-6-3-1-2-5-14(15)11-25-21(26-13-24)29-12-16(28-10-4-7-19(28)30)20(27-29)17-8-9-18(23)31-17/h1,3,5-6,8-9,16H,4,7,10-12H2,(H,25,26) |
| InChIKey | BDNCEVWJIFKSRE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|