C11H13N3 — CID 176541970
10-propan-2-yl-3,9,11-triazabicyclo[5.4.0]undeca-1,3,4,6,9-pentaene (PubChem CID 176541970) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 10-propan-2-yl-3,9,11-triazabicyclo[5.4.0]undeca-1,3,4,6,9-pentaene.
| Compound Name | 10-propan-2-yl-3,9,11-triazabicyclo[5.4.0]undeca-1,3,4,6,9-pentaene |
|---|---|
| PubChem CID | 176541970 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 10-propan-2-yl-3,9,11-triazabicyclo[5.4.0]undeca-1,3,4,6,9-pentaene |
| SMILES | CC(C)C1=NCC2=CC=C=NC=C2N1 |
| InChI | InChI=1S/C11H13N3/c1-8(2)11-13-6-9-4-3-5-12-7-10(9)14-11/h3-4,7-8H,6H2,1-2H3,(H,13,14) |
| InChIKey | HUFPYOKABWNMAG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |