C11H16FN5O3 — CID 176541984
(2S,3S,4S,5R)-2-fluoro-2-(hydroxymethyl)-5-(6-imino-4,5-dihydro-1H-purin-9-yl)-4-methyloxolan-3-ol (PubChem CID 176541984) has the molecular formula C11H16FN5O3 and a molecular weight of 285.28 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-fluoro-2-(hydroxymethyl)-5-(6-imino-4,5-dihydro-1H-purin-9-yl)-4-methyloxolan-3-ol.
| Compound Name | (2S,3S,4S,5R)-2-fluoro-2-(hydroxymethyl)-5-(6-imino-4,5-dihydro-1H-purin-9-yl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 176541984 |
| Molecular Formula | C11H16FN5O3 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2S,3S,4S,5R)-2-fluoro-2-(hydroxymethyl)-5-(6-imino-4,5-dihydro-1H-purin-9-yl)-4-methyloxolan-3-ol |
| SMILES | [H]/N=C1\NC=NC2C1N=CN2[C@@H]1O[C@](F)(CO)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C11H16FN5O3/c1-5-7(19)11(12,2-18)20-10(5)17-4-16-6-8(13)14-3-15-9(6)17/h3-7,9-10,18-19H,2H2,1H3,(H2,13,14,15)/t5-,6?,7-,9?,10+,11+/m0/s1 |
| InChIKey | VCYWSHPYLRCAGD-LUHYIGGDSA-N |
| XLogP | -1.35 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|