About methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate
methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate (PubChem CID 176542377) has the molecular formula C12H10N2O3
and a molecular weight of 230.22 g/mol. Its IUPAC name is methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate |
| PubChem CID | 176542377 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)NC(=C=O)C21CC1 |
| InChI | InChI=1S/C12H10N2O3/c1-17-11(16)8-3-2-7-10(13-8)14-9(6-15)12(7)4-5-12/h2-3H,4-5H2,1H3,(H,13,14) |
| InChIKey | IVUNMKLBGGLNCT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate?
The IUPAC name of methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate (CID 176542377) is methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate.
What is the SMILES notation for methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate?
The canonical SMILES for methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate is COC(=O)c1ccc2c(n1)NC(=C=O)C21CC1.
What is the InChIKey of methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate?
The InChIKey is IVUNMKLBGGLNCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3/c1-17-11(16)8-3-2-7-10(13-8)14-9(6-15)12(7)4-5-12/h2-3H,4-5H2,1H3,(H,13,14).
What are the key properties of methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate?
methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate has a molecular weight of 230.22 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(oxomethylidene)spiro[1H-pyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-6-carboxylate is sourced from PubChem (CID 176542377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).