About N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide
N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide (PubChem CID 176542611) has the molecular formula C23H28BrN4P
and a molecular weight of 471.38 g/mol. Its IUPAC name is N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide.
Molecular Properties
| Compound Name | N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide |
| PubChem CID | 176542611 |
| Molecular Formula | C23H28BrN4P |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide |
| SMILES | [Br-].[H]/N=C(\C)N/C(N)=N/CC.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C5H12N4.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-8-5(7)9-4(2)6;/h1-15H;3H2,1-2H3,(H4,6,7,8,9);1H |
| InChIKey | KARJPYLYIQZIBN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide?
The IUPAC name of N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide (CID 176542611) is N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide.
What is the SMILES notation for N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide?
The canonical SMILES for N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide is [Br-].[H]/N=C(\C)N/C(N)=N/CC.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide?
The InChIKey is KARJPYLYIQZIBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C5H12N4.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-8-5(7)9-4(2)6;/h1-15H;3H2,1-2H3,(H4,6,7,8,9);1H.
What are the key properties of N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide?
N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide has a molecular weight of 471.38 g/mol, XLogP of 0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-ethylcarbamimidoyl)ethanimidamide;triphenylphosphanium;bromide is sourced from PubChem (CID 176542611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).