C18H23F3N4O — CID 176542700
3-[4-[(1-methylcyclopropyl)amino]-6-[(3S)-4,4,4-trifluoro-3-methylbutyl]-1,3,5-triazin-2-yl]cyclohexa-1,2-dien-1-ol (PubChem CID 176542700) has the molecular formula C18H23F3N4O and a molecular weight of 368.40 g/mol. Its IUPAC name is 3-[4-[(1-methylcyclopropyl)amino]-6-[(3S)-4,4,4-trifluoro-3-methylbutyl]-1,3,5-triazin-2-yl]cyclohexa-1,2-dien-1-ol.
| Compound Name | 3-[4-[(1-methylcyclopropyl)amino]-6-[(3S)-4,4,4-trifluoro-3-methylbutyl]-1,3,5-triazin-2-yl]cyclohexa-1,2-dien-1-ol |
|---|---|
| PubChem CID | 176542700 |
| Molecular Formula | C18H23F3N4O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[4-[(1-methylcyclopropyl)amino]-6-[(3S)-4,4,4-trifluoro-3-methylbutyl]-1,3,5-triazin-2-yl]cyclohexa-1,2-dien-1-ol |
| SMILES | C[C@@H](CCc1nc(NC2(C)CC2)nc(C2=C=C(O)CCC2)n1)C(F)(F)F |
| InChI | InChI=1S/C18H23F3N4O/c1-11(18(19,20)21)6-7-14-22-15(12-4-3-5-13(26)10-12)24-16(23-14)25-17(2)8-9-17/h11,26H,3-9H2,1-2H3,(H,22,23,24,25)/t11-/m0/s1 |
| InChIKey | JWRCAGDDSDXUKA-NSHDSACASA-N |
| XLogP | 4.58 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |