C13H24N8O — CID 176542978
1-[(E)-[(1S,3aS,7aR)-1-[(E)-(diaminomethylidenehydrazinylidene)methyl]-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-ylidene]amino]guanidine (PubChem CID 176542978) has the molecular formula C13H24N8O and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-[(E)-[(1S,3aS,7aR)-1-[(E)-(diaminomethylidenehydrazinylidene)methyl]-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-ylidene]amino]guanidine.
| Compound Name | 1-[(E)-[(1S,3aS,7aR)-1-[(E)-(diaminomethylidenehydrazinylidene)methyl]-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 176542978 |
| Molecular Formula | C13H24N8O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-[(E)-[(1S,3aS,7aR)-1-[(E)-(diaminomethylidenehydrazinylidene)methyl]-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-ylidene]amino]guanidine |
| SMILES | [H]/N=C(\N)N/N=C1\CC[C@]2(C)[C@@H](/C=N/N=C(N)N)CC[C@]2(O)C1 |
| InChI | InChI=1S/C13H24N8O/c1-12-4-3-9(19-21-11(16)17)6-13(12,22)5-2-8(12)7-18-20-10(14)15/h7-8,22H,2-6H2,1H3,(H4,14,15,20)(H4,16,17,21)/b18-7+,19-9+/t8-,12-,13+/m1/s1 |
| InChIKey | IIMJPONRZVCTFP-PWACVWSESA-N |
| XLogP | -0.58 |
| TPSA | 171.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|