C18H17N5 — CID 176543243
6-cyclohepta-1,3,5,6-tetraen-1-yl-2-N,2-N-dimethyl-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 176543243) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 6-cyclohepta-1,3,5,6-tetraen-1-yl-2-N,2-N-dimethyl-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cyclohepta-1,3,5,6-tetraen-1-yl-2-N,2-N-dimethyl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 176543243 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 6-cyclohepta-1,3,5,6-tetraen-1-yl-2-N,2-N-dimethyl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(Nc2ccccc2)nc(C2=CC=CC=C=C2)n1 |
| InChI | InChI=1S/C18H17N5/c1-23(2)18-21-16(14-10-6-3-4-7-11-14)20-17(22-18)19-15-12-8-5-9-13-15/h3-6,8-13H,1-2H3,(H,19,20,21,22) |
| InChIKey | IILRCRRCAGMZFE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |