C16H20N4O2 — CID 176543341
N'-(ethenylideneamino)-N-[(E)-(3-methylphenyl)methylideneamino]hexanediamide (PubChem CID 176543341) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N'-(ethenylideneamino)-N-[(E)-(3-methylphenyl)methylideneamino]hexanediamide.
| Compound Name | N'-(ethenylideneamino)-N-[(E)-(3-methylphenyl)methylideneamino]hexanediamide |
|---|---|
| PubChem CID | 176543341 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N'-(ethenylideneamino)-N-[(E)-(3-methylphenyl)methylideneamino]hexanediamide |
| SMILES | C=C=NNC(=O)CCCCC(=O)N/N=C/c1cccc(C)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-3-17-19-15(21)9-4-5-10-16(22)20-18-12-14-8-6-7-13(2)11-14/h6-8,11-12H,1,4-5,9-10H2,2H3,(H,19,21)(H,20,22)/b18-12+ |
| InChIKey | BOLJDEUTUNTNRJ-LDADJPATSA-N |
| XLogP | 1.89 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|