About 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine
5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine (PubChem CID 176543440) has the molecular formula C5H7IN4
and a molecular weight of 250.04 g/mol. Its IUPAC name is 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine.
Molecular Properties
| Compound Name | 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine |
| PubChem CID | 176543440 |
| Molecular Formula | C5H7IN4 |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine |
| SMILES | C=C1N=CN=C1N/I=N/C |
| InChI | InChI=1S/C5H7IN4/c1-4-5(9-3-8-4)10-6-7-2/h3H,1H2,2H3,(H,7,8,9,10) |
| InChIKey | QMXLISAPFDGSPD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine?
The IUPAC name of 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine (CID 176543440) is 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine.
What is the SMILES notation for 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine?
The canonical SMILES for 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine is C=C1N=CN=C1N/I=N/C.
What is the InChIKey of 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine?
The InChIKey is QMXLISAPFDGSPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7IN4/c1-4-5(9-3-8-4)10-6-7-2/h3H,1H2,2H3,(H,7,8,9,10).
What are the key properties of 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine?
5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine has a molecular weight of 250.04 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-N-(methylimino-λ3-iodanyl)imidazol-4-amine is sourced from PubChem (CID 176543440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).