About N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide
N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide (PubChem CID 176543631) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide.
Molecular Properties
| Compound Name | N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide |
| PubChem CID | 176543631 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NCC(=C/C)/C(=C\C)C(C)=O |
| InChI | InChI=1S/C13H17NO2/c1-5-8-13(16)14-9-11(6-2)12(7-3)10(4)15/h6-8H,1,9H2,2-4H3,(H,14,16)/b11-6-,12-7- |
| InChIKey | NGEMQKABHWVBDM-IODUZNRKSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide?
The IUPAC name of N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide (CID 176543631) is N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide.
What is the SMILES notation for N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide?
The canonical SMILES for N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide is C=C=CC(=O)NCC(=C/C)/C(=C\C)C(C)=O.
What is the InChIKey of N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide?
The InChIKey is NGEMQKABHWVBDM-IODUZNRKSA-N. The full InChI is InChI=1S/C13H17NO2/c1-5-8-13(16)14-9-11(6-2)12(7-3)10(4)15/h6-8H,1,9H2,2-4H3,(H,14,16)/b11-6-,12-7-.
What are the key properties of N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide?
N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide has a molecular weight of 219.28 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide is sourced from PubChem (CID 176543631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).