C13H17NO2 — CID 176543631
N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide (PubChem CID 176543631) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide.
| Compound Name | N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176543631 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[(E,2E)-3-acetyl-2-ethylidenepent-3-enyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NCC(=C/C)/C(=C\C)C(C)=O |
| InChI | InChI=1S/C13H17NO2/c1-5-8-13(16)14-9-11(6-2)12(7-3)10(4)15/h6-8H,1,9H2,2-4H3,(H,14,16)/b11-6-,12-7- |
| InChIKey | NGEMQKABHWVBDM-IODUZNRKSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|