C12H21N5 — CID 176543827
1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(N,N-dimethylcarbamimidoyl)-2-methylguanidine (PubChem CID 176543827) has the molecular formula C12H21N5 and a molecular weight of 235.34 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(N,N-dimethylcarbamimidoyl)-2-methylguanidine.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(N,N-dimethylcarbamimidoyl)-2-methylguanidine |
|---|---|
| PubChem CID | 176543827 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3-(N,N-dimethylcarbamimidoyl)-2-methylguanidine |
| SMILES | [H]/N=C(/N/C(=N\C)NCC1=CCCC=C1)N(C)C |
| InChI | InChI=1S/C12H21N5/c1-14-12(16-11(13)17(2)3)15-9-10-7-5-4-6-8-10/h5,7-8H,4,6,9H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | IFVPBQUFOXCNJM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|