C31H59N7 — CID 176544057
1,3-dicyclohexyl-2-[2-[3-[(N,N'-dicyclohexylcarbamimidoyl)amino]propylamino]ethyl]guanidine (PubChem CID 176544057) has the molecular formula C31H59N7 and a molecular weight of 529.86 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2-[2-[3-[(N,N'-dicyclohexylcarbamimidoyl)amino]propylamino]ethyl]guanidine.
| Compound Name | 1,3-dicyclohexyl-2-[2-[3-[(N,N'-dicyclohexylcarbamimidoyl)amino]propylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 176544057 |
| Molecular Formula | C31H59N7 |
| Molecular Weight | 529.86 g/mol |
| Exact Mass | 529.48 |
| IUPAC Name | 1,3-dicyclohexyl-2-[2-[3-[(N,N'-dicyclohexylcarbamimidoyl)amino]propylamino]ethyl]guanidine |
| SMILES | C1CCC(/N=C(\NCCCNCCN=C(NC2CCCCC2)NC2CCCCC2)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C31H59N7/c1-5-14-26(15-6-1)35-30(36-27-16-7-2-8-17-27)33-23-13-22-32-24-25-34-31(37-28-18-9-3-10-19-28)38-29-20-11-4-12-21-29/h26-29,32H,1-25H2,(H2,33,35,36)(H2,34,37,38) |
| InChIKey | WGYDKONQGBACMT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.86 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|