About 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione
2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione (PubChem CID 176544156) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione.
Molecular Properties
| Compound Name | 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione |
| PubChem CID | 176544156 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione |
| SMILES | CC(=C=N)C1=NC(=O)CC(=O)N1 |
| InChI | InChI=1S/C7H7N3O2/c1-4(3-8)7-9-5(11)2-6(12)10-7/h8H,2H2,1H3,(H,9,10,11,12) |
| InChIKey | ALAFVGYIIPQVJW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 82.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione?
The IUPAC name of 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione (CID 176544156) is 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione.
What is the SMILES notation for 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione?
The canonical SMILES for 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione is CC(=C=N)C1=NC(=O)CC(=O)N1.
What is the InChIKey of 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione?
The InChIKey is ALAFVGYIIPQVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-4(3-8)7-9-5(11)2-6(12)10-7/h8H,2H2,1H3,(H,9,10,11,12).
What are the key properties of 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione?
2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione has a molecular weight of 165.15 g/mol, XLogP of -0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-iminoprop-1-en-2-yl)-1H-pyrimidine-4,6-dione is sourced from PubChem (CID 176544156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).