About N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine
N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine (PubChem CID 176544357) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine.
Molecular Properties
| Compound Name | N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine |
| PubChem CID | 176544357 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine |
| SMILES | [H]/N=C1\C=C(C)C(NCNC=C=C)=C\C1=C\C |
| InChI | InChI=1S/C13H17N3/c1-4-6-15-9-16-13-8-11(5-2)12(14)7-10(13)3/h5-8,14-16H,1,9H2,2-3H3/b11-5-,14-12+ |
| InChIKey | PTBRRFWBVFAUFZ-AHMRWDIVSA-N |
| XLogP | 2.23 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine?
The IUPAC name of N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine (CID 176544357) is N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine.
What is the SMILES notation for N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine?
The canonical SMILES for N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine is [H]/N=C1\C=C(C)C(NCNC=C=C)=C\C1=C\C.
What is the InChIKey of N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine?
The InChIKey is PTBRRFWBVFAUFZ-AHMRWDIVSA-N. The full InChI is InChI=1S/C13H17N3/c1-4-6-15-9-16-13-8-11(5-2)12(14)7-10(13)3/h5-8,14-16H,1,9H2,2-3H3/b11-5-,14-12+.
What are the key properties of N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine?
N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine has a molecular weight of 215.30 g/mol, XLogP of 2.23, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3Z)-3-ethylidene-4-imino-6-methylcyclohexa-1,5-dien-1-yl]-N-propa-1,2-dienylmethanediamine is sourced from PubChem (CID 176544357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).