C35H44N6O4 — CID 176544374
3-[3-[(2E)-2-[1-(2,3-dihydro-1H-inden-5-yl)-3-methyl-5-(oxomethylidene)pyrazol-4-ylidene]hydrazinyl]-2-hydroxyphenyl]benzoic acid;bis(N-ethylethanamine) (PubChem CID 176544374) has the molecular formula C35H44N6O4 and a molecular weight of 612.78 g/mol. Its IUPAC name is 3-[3-[(2E)-2-[1-(2,3-dihydro-1H-inden-5-yl)-3-methyl-5-(oxomethylidene)pyrazol-4-ylidene]hydrazinyl]-2-hydroxyphenyl]benzoic acid;bis(N-ethylethanamine).
| Compound Name | 3-[3-[(2E)-2-[1-(2,3-dihydro-1H-inden-5-yl)-3-methyl-5-(oxomethylidene)pyrazol-4-ylidene]hydrazinyl]-2-hydroxyphenyl]benzoic acid;bis(N-ethylethanamine) |
|---|---|
| PubChem CID | 176544374 |
| Molecular Formula | C35H44N6O4 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | 3-[3-[(2E)-2-[1-(2,3-dihydro-1H-inden-5-yl)-3-methyl-5-(oxomethylidene)pyrazol-4-ylidene]hydrazinyl]-2-hydroxyphenyl]benzoic acid;bis(N-ethylethanamine) |
| SMILES | CC1=NN(c2ccc3c(c2)CCC3)C(=C=O)/C1=N\Nc1cccc(-c2cccc(C(=O)O)c2)c1O.CCNCC.CCNCC |
| InChI | InChI=1S/C27H22N4O4.2C4H11N/c1-16-25(24(15-32)31(30-16)21-12-11-17-5-2-6-18(17)14-21)29-28-23-10-4-9-22(26(23)33)19-7-3-8-20(13-19)27(34)35;2*1-3-5-4-2/h3-4,7-14,28,33H,2,5-6H2,1H3,(H,34,35);2*5H,3-4H2,1-2H3/b29-25-;; |
| InChIKey | KODQFMQFMODGHD-LEJUFYTLSA-N |
| XLogP | 5.86 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|