About 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine
2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine (PubChem CID 176544443) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine.
Molecular Properties
| Compound Name | 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine |
| PubChem CID | 176544443 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine |
| SMILES | NC1=CC2=C(C=C=C1)OCCO2 |
| InChI | InChI=1S/C9H9NO2/c10-7-2-1-3-8-9(6-7)12-5-4-11-8/h2-3,6H,4-5,10H2 |
| InChIKey | KPZSNFJDHRMYAN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine?
The IUPAC name of 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine (CID 176544443) is 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine.
What is the SMILES notation for 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine?
The canonical SMILES for 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine is NC1=CC2=C(C=C=C1)OCCO2.
What is the InChIKey of 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine?
The InChIKey is KPZSNFJDHRMYAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c10-7-2-1-3-8-9(6-7)12-5-4-11-8/h2-3,6H,4-5,10H2.
What are the key properties of 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine?
2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine has a molecular weight of 163.18 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrocyclohepta[b][1,4]dioxin-6-amine is sourced from PubChem (CID 176544443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).