C11H18FNO2 — CID 176544836
propan-2-yl (2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (PubChem CID 176544836) has the molecular formula C11H18FNO2 and a molecular weight of 215.27 g/mol. Its IUPAC name is propan-2-yl (2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.
| Compound Name | propan-2-yl (2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 176544836 |
| Molecular Formula | C11H18FNO2 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | propan-2-yl (2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| SMILES | CC(C)OC(=O)[C@@]12CCCN1C[C@H](F)C2 |
| InChI | InChI=1S/C11H18FNO2/c1-8(2)15-10(14)11-4-3-5-13(11)7-9(12)6-11/h8-9H,3-7H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | BUPRNKYYLFFJAU-KOLCDFICSA-N |
| XLogP | 1.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |