C11H21N5 — CID 176545634
N-(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-1-carboximidamide (PubChem CID 176545634) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-1-carboximidamide.
| Compound Name | N-(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 176545634 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N-(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(/NC1=NCCC(C)N1)N1CCCCC1 |
| InChI | InChI=1S/C11H21N5/c1-9-5-6-13-11(14-9)15-10(12)16-7-3-2-4-8-16/h9H,2-8H2,1H3,(H3,12,13,14,15) |
| InChIKey | JGTBGISQQOZNCN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|