C38H45N5 — CID 176545705
9-[3-(4-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-yl-1,2-dihydro-1,3,5-triazin-6-yl)-6-(4-methylazetidin-2-yl)cyclohexa-1,5-dien-1-yl]-1,5,6,8a,9,9a,10,10a-octahydroacridine (PubChem CID 176545705) has the molecular formula C38H45N5 and a molecular weight of 571.81 g/mol. Its IUPAC name is 9-[3-(4-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-yl-1,2-dihydro-1,3,5-triazin-6-yl)-6-(4-methylazetidin-2-yl)cyclohexa-1,5-dien-1-yl]-1,5,6,8a,9,9a,10,10a-octahydroacridine.
| Compound Name | 9-[3-(4-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-yl-1,2-dihydro-1,3,5-triazin-6-yl)-6-(4-methylazetidin-2-yl)cyclohexa-1,5-dien-1-yl]-1,5,6,8a,9,9a,10,10a-octahydroacridine |
|---|---|
| PubChem CID | 176545705 |
| Molecular Formula | C38H45N5 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.37 |
| IUPAC Name | 9-[3-(4-cyclohexa-1,5-dien-1-yl-2-cyclohexa-2,4-dien-1-yl-1,2-dihydro-1,3,5-triazin-6-yl)-6-(4-methylazetidin-2-yl)cyclohexa-1,5-dien-1-yl]-1,5,6,8a,9,9a,10,10a-octahydroacridine |
| SMILES | CC1CC(C2=CCC(C3=NC(C4=CCCC=C4)=NC(C4C=CC=CC4)N3)C=C2C2C3CC=CC=C3NC3CCC=CC32)N1 |
| InChI | InChI=1S/C38H45N5/c1-24-22-34(39-24)28-21-20-27(23-31(28)35-29-16-8-10-18-32(29)40-33-19-11-9-17-30(33)35)38-42-36(25-12-4-2-5-13-25)41-37(43-38)26-14-6-3-7-15-26/h2,4-6,8-10,12,14-15,17-18,21,23-25,27,29-30,33-36,39-40H,3,7,11,13,16,19-20,22H2,1H3,(H,41,42,43) |
| InChIKey | LGHRBAGKVUJASJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|