C18H18N4O2S — CID 176545777
1-[[2-[(3S)-morpholin-3-yl]phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 176545777) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-[[2-[(3S)-morpholin-3-yl]phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 1-[[2-[(3S)-morpholin-3-yl]phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 176545777 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[[2-[(3S)-morpholin-3-yl]phenyl]methyl]-2-(sulfanylidenemethylidene)-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | O=C1NC(=C=S)N(Cc2ccccc2[C@H]2COCCN2)c2cc[nH]c21 |
| InChI | InChI=1S/C18H18N4O2S/c23-18-17-15(5-6-20-17)22(16(11-25)21-18)9-12-3-1-2-4-13(12)14-10-24-8-7-19-14/h1-6,14,19-20H,7-10H2,(H,21,23)/t14-/m1/s1 |
| InChIKey | QILNLMWWWPYZHB-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|